C16H16ClN3O3 — CID 9297573
3-(carbamoylamino)-N-[2-(4-chlorophenoxy)ethyl]benzamide (PubChem CID 9297573) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[2-(4-chlorophenoxy)ethyl]benzamide.
| Compound Name | 3-(carbamoylamino)-N-[2-(4-chlorophenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 9297573 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-(carbamoylamino)-N-[2-(4-chlorophenoxy)ethyl]benzamide |
| SMILES | NC(=O)Nc1cccc(C(=O)NCCOc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H16ClN3O3/c17-12-4-6-14(7-5-12)23-9-8-19-15(21)11-2-1-3-13(10-11)20-16(18)22/h1-7,10H,8-9H2,(H,19,21)(H3,18,20,22) |
| InChIKey | BVDLDGUEFNXEOA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|