C16H14BrClN2O3 — CID 3253612
2-[(3-bromobenzoyl)amino]ethyl N-(4-chlorophenyl)carbamate (PubChem CID 3253612) has the molecular formula C16H14BrClN2O3 and a molecular weight of 397.66 g/mol. Its IUPAC name is 2-[(3-bromobenzoyl)amino]ethyl N-(4-chlorophenyl)carbamate.
| Compound Name | 2-[(3-bromobenzoyl)amino]ethyl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 3253612 |
| Molecular Formula | C16H14BrClN2O3 |
| Molecular Weight | 397.66 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-[(3-bromobenzoyl)amino]ethyl N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1)OCCNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H14BrClN2O3/c17-12-3-1-2-11(10-12)15(21)19-8-9-23-16(22)20-14-6-4-13(18)5-7-14/h1-7,10H,8-9H2,(H,19,21)(H,20,22) |
| InChIKey | QXDSIEZZEVPUQY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|