C12H18N4O2 — CID 119496000
N-(3-aminobutyl)-3-(carbamoylamino)benzamide (PubChem CID 119496000) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-(carbamoylamino)benzamide.
| Compound Name | N-(3-aminobutyl)-3-(carbamoylamino)benzamide |
|---|---|
| PubChem CID | 119496000 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-(3-aminobutyl)-3-(carbamoylamino)benzamide |
| SMILES | CC(N)CCNC(=O)c1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C12H18N4O2/c1-8(13)5-6-15-11(17)9-3-2-4-10(7-9)16-12(14)18/h2-4,7-8H,5-6,13H2,1H3,(H,15,17)(H3,14,16,18) |
| InChIKey | VURCUTAWQXICCE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |