C23H21N3O6S — CID 22268545
3-[3-[[3-(carbamoylamino)benzoyl]amino]phenyl]sulfonyl-3-phenylpropanoic acid (PubChem CID 22268545) has the molecular formula C23H21N3O6S and a molecular weight of 467.50 g/mol. Its IUPAC name is 3-[3-[[3-(carbamoylamino)benzoyl]amino]phenyl]sulfonyl-3-phenylpropanoic acid.
| Compound Name | 3-[3-[[3-(carbamoylamino)benzoyl]amino]phenyl]sulfonyl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22268545 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 3-[3-[[3-(carbamoylamino)benzoyl]amino]phenyl]sulfonyl-3-phenylpropanoic acid |
| SMILES | NC(=O)Nc1cccc(C(=O)Nc2cccc(S(=O)(=O)C(CC(=O)O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H21N3O6S/c24-23(30)26-17-9-4-8-16(12-17)22(29)25-18-10-5-11-19(13-18)33(31,32)20(14-21(27)28)15-6-2-1-3-7-15/h1-13,20H,14H2,(H,25,29)(H,27,28)(H3,24,26,30) |
| InChIKey | SGTHBFFVTDEEIE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |