C23H22N4O5S — CID 22268440
3-[4-[[4-(diaminomethylideneamino)benzoyl]amino]phenyl]sulfonyl-3-phenylpropanoic acid (PubChem CID 22268440) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is 3-[4-[[4-(diaminomethylideneamino)benzoyl]amino]phenyl]sulfonyl-3-phenylpropanoic acid.
| Compound Name | 3-[4-[[4-(diaminomethylideneamino)benzoyl]amino]phenyl]sulfonyl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22268440 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 3-[4-[[4-(diaminomethylideneamino)benzoyl]amino]phenyl]sulfonyl-3-phenylpropanoic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Nc2ccc(S(=O)(=O)C(CC(=O)O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O5S/c24-23(25)27-18-8-6-16(7-9-18)22(30)26-17-10-12-19(13-11-17)33(31,32)20(14-21(28)29)15-4-2-1-3-5-15/h1-13,20H,14H2,(H,26,30)(H,28,29)(H4,24,25,27) |
| InChIKey | SJLXKLCRYKCCCO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|