C29H27N5O5S — CID 70188246
3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-[(4-phenylbenzoyl)amino]propanoic acid (PubChem CID 70188246) has the molecular formula C29H27N5O5S and a molecular weight of 557.63 g/mol. Its IUPAC name is 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-[(4-phenylbenzoyl)amino]propanoic acid.
| Compound Name | 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-[(4-phenylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70188246 |
| Molecular Formula | C29H27N5O5S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-[(4-phenylbenzoyl)amino]propanoic acid |
| SMILES | NC(N)=Nc1cccc(S(=O)(=O)Nc2cccc(C(CC(=O)O)NC(=O)c3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C29H27N5O5S/c30-29(31)32-23-9-5-11-25(17-23)40(38,39)34-24-10-4-8-22(16-24)26(18-27(35)36)33-28(37)21-14-12-20(13-15-21)19-6-2-1-3-7-19/h1-17,26,34H,18H2,(H,33,37)(H,35,36)(H4,30,31,32) |
| InChIKey | LBNYREKCQJMPCV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|