C20H21N5O6S3 — CID 70189323
3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(thiophen-2-ylsulfonylamino)propanoic acid (PubChem CID 70189323) has the molecular formula C20H21N5O6S3 and a molecular weight of 523.62 g/mol. Its IUPAC name is 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(thiophen-2-ylsulfonylamino)propanoic acid.
| Compound Name | 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(thiophen-2-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 70189323 |
| Molecular Formula | C20H21N5O6S3 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 3-[3-[[3-(diaminomethylideneamino)phenyl]sulfonylamino]phenyl]-3-(thiophen-2-ylsulfonylamino)propanoic acid |
| SMILES | NC(N)=Nc1cccc(S(=O)(=O)Nc2cccc(C(CC(=O)O)NS(=O)(=O)c3cccs3)c2)c1 |
| InChI | InChI=1S/C20H21N5O6S3/c21-20(22)23-14-5-2-7-16(11-14)33(28,29)24-15-6-1-4-13(10-15)17(12-18(26)27)25-34(30,31)19-8-3-9-32-19/h1-11,17,24-25H,12H2,(H,26,27)(H4,21,22,23) |
| InChIKey | SLBHTDQAPBKWMA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 194.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|