C20H23N3O8S — CID 166728908
3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(3-nitrophenyl)sulfonylamino]phenyl]propanoic acid (PubChem CID 166728908) has the molecular formula C20H23N3O8S and a molecular weight of 465.48 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(3-nitrophenyl)sulfonylamino]phenyl]propanoic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(3-nitrophenyl)sulfonylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 166728908 |
| Molecular Formula | C20H23N3O8S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(3-nitrophenyl)sulfonylamino]phenyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)c1cccc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H23N3O8S/c1-20(2,3)31-19(26)21-17(12-18(24)25)13-6-4-7-14(10-13)22-32(29,30)16-9-5-8-15(11-16)23(27)28/h4-11,17,22H,12H2,1-3H3,(H,21,26)(H,24,25) |
| InChIKey | SSSVKQYMDQOIKH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|