C15H19ClN2O6 — CID 165440771
chloromethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoate (PubChem CID 165440771) has the molecular formula C15H19ClN2O6 and a molecular weight of 358.78 g/mol. Its IUPAC name is chloromethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoate.
| Compound Name | chloromethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 165440771 |
| Molecular Formula | C15H19ClN2O6 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | chloromethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OCCl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19ClN2O6/c1-15(2,3)24-14(20)17-12(8-13(19)23-9-16)10-5-4-6-11(7-10)18(21)22/h4-7,12H,8-9H2,1-3H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | QGKSJPGSXKIGJD-LBPRGKRZSA-N |
| XLogP | 3.29 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|