C26H24N4O7 — CID 20600846
methyl 3-[(9H-fluoren-9-ylmethoxycarbonylamino)carbamoylamino]-3-(3-nitrophenyl)propanoate (PubChem CID 20600846) has the molecular formula C26H24N4O7 and a molecular weight of 504.50 g/mol. Its IUPAC name is methyl 3-[(9H-fluoren-9-ylmethoxycarbonylamino)carbamoylamino]-3-(3-nitrophenyl)propanoate.
| Compound Name | methyl 3-[(9H-fluoren-9-ylmethoxycarbonylamino)carbamoylamino]-3-(3-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 20600846 |
| Molecular Formula | C26H24N4O7 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | methyl 3-[(9H-fluoren-9-ylmethoxycarbonylamino)carbamoylamino]-3-(3-nitrophenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)NNC(=O)OCC1c2ccccc2-c2ccccc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H24N4O7/c1-36-24(31)14-23(16-7-6-8-17(13-16)30(34)35)27-25(32)28-29-26(33)37-15-22-20-11-4-2-9-18(20)19-10-3-5-12-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,29,33)(H2,27,28,32) |
| InChIKey | UIUDBBJFWVWPNC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|