C24H20LiNO4 — CID 170576317
lithium (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate (PubChem CID 170576317) has the molecular formula C24H20LiNO4 and a molecular weight of 393.37 g/mol. Its IUPAC name is lithium (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate.
| Compound Name | lithium (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 170576317 |
| Molecular Formula | C24H20LiNO4 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | lithium (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
| SMILES | O=C([O-])C[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1.[Li+] |
| InChI | InChI=1S/C24H21NO4.Li/c26-23(27)14-22(16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21;/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27);/q;+1/p-1/t22-;/m1./s1 |
| InChIKey | PJYWHCQLUGRWIO-VZYDHVRKSA-M |
| XLogP | 0.41 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |