C24H22N2O3 — CID 25187710
9H-fluoren-9-ylmethyl N-[(1R)-2-formamido-1-phenylethyl]carbamate (PubChem CID 25187710) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(1R)-2-formamido-1-phenylethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(1R)-2-formamido-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 25187710 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(1R)-2-formamido-1-phenylethyl]carbamate |
| SMILES | O=CNC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O3/c27-16-25-14-23(17-8-2-1-3-9-17)26-24(28)29-15-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,16,22-23H,14-15H2,(H,25,27)(H,26,28)/t23-/m0/s1 |
| InChIKey | WDKMZRKUHAYIFJ-QHCPKHFHSA-N |
| XLogP | 4.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|