C24H21NO4S — CID 135021468
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenyl-3-sulfanylpropanoic acid (PubChem CID 135021468) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenyl-3-sulfanylpropanoic acid.
| Compound Name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenyl-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 135021468 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenyl-3-sulfanylpropanoic acid |
| SMILES | O=C(N[C@@H](C(=O)O)[C@H](S)c1ccccc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H21NO4S/c26-23(27)21(22(30)15-8-2-1-3-9-15)25-24(28)29-14-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)20/h1-13,20-22,30H,14H2,(H,25,28)(H,26,27)/t21-,22-/m1/s1 |
| InChIKey | RZKMXMSSBPABFV-FGZHOGPDSA-N |
| XLogP | 4.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|