C19H18NNaO8S — CID 138114573
sodium [1-carboxy-1-(9H-fluoren-9-ylmethoxycarbonylamino)propan-2-yl] sulfate (PubChem CID 138114573) has the molecular formula C19H18NNaO8S and a molecular weight of 443.41 g/mol. Its IUPAC name is sodium [1-carboxy-1-(9H-fluoren-9-ylmethoxycarbonylamino)propan-2-yl] sulfate.
| Compound Name | sodium [1-carboxy-1-(9H-fluoren-9-ylmethoxycarbonylamino)propan-2-yl] sulfate |
|---|---|
| PubChem CID | 138114573 |
| Molecular Formula | C19H18NNaO8S |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | sodium [1-carboxy-1-(9H-fluoren-9-ylmethoxycarbonylamino)propan-2-yl] sulfate |
| SMILES | CC(OS(=O)(=O)[O-])C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.[Na+] |
| InChI | InChI=1S/C19H19NO8S.Na/c1-11(28-29(24,25)26)17(18(21)22)20-19(23)27-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16;/h2-9,11,16-17H,10H2,1H3,(H,20,23)(H,21,22)(H,24,25,26);/q;+1/p-1 |
| InChIKey | DUUMOTOMYSLKCC-UHFFFAOYSA-M |
| XLogP | -1.15 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|