C38H33NO5 — CID 53394879
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxybutanoic acid (PubChem CID 53394879) has the molecular formula C38H33NO5 and a molecular weight of 583.68 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxybutanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxybutanoic acid |
|---|---|
| PubChem CID | 53394879 |
| Molecular Formula | C38H33NO5 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxybutanoic acid |
| SMILES | CC(OC(c1ccccc1)(c1ccccc1)c1ccccc1)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C38H33NO5/c1-26(44-38(27-15-5-2-6-16-27,28-17-7-3-8-18-28)29-19-9-4-10-20-29)35(36(40)41)39-37(42)43-25-34-32-23-13-11-21-30(32)31-22-12-14-24-33(31)34/h2-24,26,34-35H,25H2,1H3,(H,39,42)(H,40,41) |
| InChIKey | JARBLLDDSTVWSM-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|