C42H40N2O8 — CID 101006189
2-[[(2S,3R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]acetic acid (PubChem CID 101006189) has the molecular formula C42H40N2O8 and a molecular weight of 700.79 g/mol. Its IUPAC name is 2-[[(2S,3R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S,3R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 101006189 |
| Molecular Formula | C42H40N2O8 |
| Molecular Weight | 700.79 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | 2-[[(2S,3R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]acetic acid |
| SMILES | COc1ccc(C(O[C@H](C)[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)NCC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H40N2O8/c1-27(52-42(28-11-5-4-6-12-28,29-17-21-31(49-2)22-18-29)30-19-23-32(50-3)24-20-30)39(40(47)43-25-38(45)46)44-41(48)51-26-37-35-15-9-7-13-33(35)34-14-8-10-16-36(34)37/h4-24,27,37,39H,25-26H2,1-3H3,(H,43,47)(H,44,48)(H,45,46)/t27-,39+/m1/s1 |
| InChIKey | NKOGMQGEHFPKTG-XILKZKBSSA-N |
| XLogP | 6.51 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.79 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|