C41H39NO7 — CID 97294827
[(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propyl] acetate (PubChem CID 97294827) has the molecular formula C41H39NO7 and a molecular weight of 657.76 g/mol. Its IUPAC name is [(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propyl] acetate.
| Compound Name | [(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propyl] acetate |
|---|---|
| PubChem CID | 97294827 |
| Molecular Formula | C41H39NO7 |
| Molecular Weight | 657.76 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | [(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propyl] acetate |
| SMILES | COc1ccc(C(OC[C@@H](COC(C)=O)NC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H39NO7/c1-28(43)47-25-32(42-40(44)48-27-39-37-15-9-7-13-35(37)36-14-8-10-16-38(36)39)26-49-41(29-11-5-4-6-12-29,30-17-21-33(45-2)22-18-30)31-19-23-34(46-3)24-20-31/h4-24,32,39H,25-27H2,1-3H3,(H,42,44)/t32-/m1/s1 |
| InChIKey | HFUWFTWNAOPHFY-JGCGQSQUSA-N |
| XLogP | 7.48 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.76 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|