C52H45NO5 — CID 51341199
bis(4-methylphenyl)methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxypropanoate (PubChem CID 51341199) has the molecular formula C52H45NO5 and a molecular weight of 763.93 g/mol. Its IUPAC name is bis(4-methylphenyl)methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxypropanoate.
| Compound Name | bis(4-methylphenyl)methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxypropanoate |
|---|---|
| PubChem CID | 51341199 |
| Molecular Formula | C52H45NO5 |
| Molecular Weight | 763.93 g/mol |
| Exact Mass | 763.33 |
| IUPAC Name | bis(4-methylphenyl)methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-trityloxypropanoate |
| SMILES | Cc1ccc(C(OC(=O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)OCC2c3ccccc3-c3ccccc32)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C52H45NO5/c1-36-26-30-38(31-27-36)49(39-32-28-37(2)29-33-39)58-50(54)48(53-51(55)56-34-47-45-24-14-12-22-43(45)44-23-13-15-25-46(44)47)35-57-52(40-16-6-3-7-17-40,41-18-8-4-9-19-41)42-20-10-5-11-21-42/h3-33,47-49H,34-35H2,1-2H3,(H,53,55)/t48-/m1/s1 |
| InChIKey | QSNRMXNXYFHQFH-QSCHNALKSA-N |
| XLogP | 10.85 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.93 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|