C46H44N2O6 — CID 51341204
tert-butyl 3-[(2S)-3-[bis(4-methylphenyl)methoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]indole-1-carboxylate (PubChem CID 51341204) has the molecular formula C46H44N2O6 and a molecular weight of 720.87 g/mol. Its IUPAC name is tert-butyl 3-[(2S)-3-[bis(4-methylphenyl)methoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2S)-3-[bis(4-methylphenyl)methoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 51341204 |
| Molecular Formula | C46H44N2O6 |
| Molecular Weight | 720.87 g/mol |
| Exact Mass | 720.32 |
| IUPAC Name | tert-butyl 3-[(2S)-3-[bis(4-methylphenyl)methoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]indole-1-carboxylate |
| SMILES | Cc1ccc(C(OC(=O)[C@H](Cc2cn(C(=O)OC(C)(C)C)c3ccccc23)NC(=O)OCC2c3ccccc3-c3ccccc32)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C46H44N2O6/c1-29-18-22-31(23-19-29)42(32-24-20-30(2)21-25-32)53-43(49)40(26-33-27-48(45(51)54-46(3,4)5)41-17-11-10-12-34(33)41)47-44(50)52-28-39-37-15-8-6-13-35(37)36-14-7-9-16-38(36)39/h6-25,27,39-40,42H,26,28H2,1-5H3,(H,47,50)/t40-/m0/s1 |
| InChIKey | LQKDTJANZPLQIB-FAIXQHPJSA-N |
| XLogP | 9.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.87 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|