C34H34N2O6 — CID 174358525
tert-butyl 3-[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-prop-2-enoxypropyl]indole-1-carboxylate (PubChem CID 174358525) has the molecular formula C34H34N2O6 and a molecular weight of 566.65 g/mol. Its IUPAC name is tert-butyl 3-[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-prop-2-enoxypropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-prop-2-enoxypropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 174358525 |
| Molecular Formula | C34H34N2O6 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | tert-butyl 3-[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-prop-2-enoxypropyl]indole-1-carboxylate |
| SMILES | C=CCOC(=O)[C@@H](Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H34N2O6/c1-5-18-40-31(37)29(19-22-20-36(33(39)42-34(2,3)4)30-17-11-10-12-23(22)30)35-32(38)41-21-28-26-15-8-6-13-24(26)25-14-7-9-16-27(25)28/h5-17,20,28-29H,1,18-19,21H2,2-4H3,(H,35,38)/t29-/m1/s1 |
| InChIKey | UZRVZLPBYDYODC-GDLZYMKVSA-N |
| XLogP | 6.60 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|