C45H34F5NO7 — CID 11377796
(2,3,4,5,6-pentafluorophenyl) (2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 11377796) has the molecular formula C45H34F5NO7 and a molecular weight of 795.76 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 11377796 |
| Molecular Formula | C45H34F5NO7 |
| Molecular Weight | 795.76 g/mol |
| Exact Mass | 795.23 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | COc1ccc(C(OC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)Oc2c(F)c(F)c(F)c(F)c2F)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H34F5NO7/c1-54-29-20-16-27(17-21-29)45(26-10-4-3-5-11-26,28-18-22-30(55-2)23-19-28)57-25-36(43(52)58-42-40(49)38(47)37(46)39(48)41(42)50)51-44(53)56-24-35-33-14-8-6-12-31(33)32-13-7-9-15-34(32)35/h3-23,35-36H,24-25H2,1-2H3,(H,51,53)/t36-/m0/s1 |
| InChIKey | NQEUWGSBZURAPH-BHVANESWSA-N |
| XLogP | 9.22 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.76 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|