C42H43NO9 — CID 58687725
9H-fluoren-9-ylmethyl N-[6-[bis(4-methoxyphenyl)-phenylmethoxy]-2,3,4,5-tetrahydroxyhexyl]carbamate (PubChem CID 58687725) has the molecular formula C42H43NO9 and a molecular weight of 705.80 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[6-[bis(4-methoxyphenyl)-phenylmethoxy]-2,3,4,5-tetrahydroxyhexyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[6-[bis(4-methoxyphenyl)-phenylmethoxy]-2,3,4,5-tetrahydroxyhexyl]carbamate |
|---|---|
| PubChem CID | 58687725 |
| Molecular Formula | C42H43NO9 |
| Molecular Weight | 705.80 g/mol |
| Exact Mass | 705.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[6-[bis(4-methoxyphenyl)-phenylmethoxy]-2,3,4,5-tetrahydroxyhexyl]carbamate |
| SMILES | COc1ccc(C(OCC(O)C(O)C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H43NO9/c1-49-30-20-16-28(17-21-30)42(27-10-4-3-5-11-27,29-18-22-31(50-2)23-19-29)52-26-38(45)40(47)39(46)37(44)24-43-41(48)51-25-36-34-14-8-6-12-32(34)33-13-7-9-15-35(33)36/h3-23,36-40,44-47H,24-26H2,1-2H3,(H,43,48) |
| InChIKey | MIIOVJPEMNPPIM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.80 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|