C25H28O6 — CID 67864554
(2R,3R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]butane-1,2,3-triol (PubChem CID 67864554) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is (2R,3R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]butane-1,2,3-triol.
| Compound Name | (2R,3R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]butane-1,2,3-triol |
|---|---|
| PubChem CID | 67864554 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (2R,3R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]butane-1,2,3-triol |
| SMILES | COc1ccc(C(OC[C@@H](O)[C@H](O)CO)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H28O6/c1-29-21-12-8-19(9-13-21)25(18-6-4-3-5-7-18,31-17-24(28)23(27)16-26)20-10-14-22(30-2)15-11-20/h3-15,23-24,26-28H,16-17H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | CWSKDEJZBDFEBX-DNQXCXABSA-N |
| XLogP | 2.73 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|