C25H29NO4 — CID 135215394
3-amino-4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol (PubChem CID 135215394) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-amino-4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol.
| Compound Name | 3-amino-4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol |
|---|---|
| PubChem CID | 135215394 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 3-amino-4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-ol |
| SMILES | COc1ccc(C(OCC(N)C(C)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H29NO4/c1-18(27)24(26)17-30-25(19-7-5-4-6-8-19,20-9-13-22(28-2)14-10-20)21-11-15-23(29-3)16-12-21/h4-16,18,24,27H,17,26H2,1-3H3 |
| InChIKey | QJFBUWPILFQLNF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|