C40H44O5Si — CID 142497064
(2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[tert-butyl(diphenyl)silyl]oxypropan-2-ol (PubChem CID 142497064) has the molecular formula C40H44O5Si and a molecular weight of 632.87 g/mol. Its IUPAC name is (2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[tert-butyl(diphenyl)silyl]oxypropan-2-ol.
| Compound Name | (2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[tert-butyl(diphenyl)silyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 142497064 |
| Molecular Formula | C40H44O5Si |
| Molecular Weight | 632.87 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | (2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[tert-butyl(diphenyl)silyl]oxypropan-2-ol |
| SMILES | COc1ccc(C(OC[C@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H44O5Si/c1-39(2,3)46(37-17-11-7-12-18-37,38-19-13-8-14-20-38)45-30-34(41)29-44-40(31-15-9-6-10-16-31,32-21-25-35(42-4)26-22-32)33-23-27-36(43-5)28-24-33/h6-28,34,41H,29-30H2,1-5H3/t34-/m0/s1 |
| InChIKey | YUEWUPGZROOHIH-UMSFTDKQSA-N |
| XLogP | 6.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.87 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|