C47H56O4Si — CID 59381468
[(E)-10-[bis(4-methoxyphenyl)-phenylmethoxy]dec-4-enoxy]-tert-butyl-diphenylsilane (PubChem CID 59381468) has the molecular formula C47H56O4Si and a molecular weight of 713.05 g/mol. Its IUPAC name is [(E)-10-[bis(4-methoxyphenyl)-phenylmethoxy]dec-4-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(E)-10-[bis(4-methoxyphenyl)-phenylmethoxy]dec-4-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 59381468 |
| Molecular Formula | C47H56O4Si |
| Molecular Weight | 713.05 g/mol |
| Exact Mass | 712.39 |
| IUPAC Name | [(E)-10-[bis(4-methoxyphenyl)-phenylmethoxy]dec-4-enoxy]-tert-butyl-diphenylsilane |
| SMILES | COc1ccc(C(OCCCCC/C=C/CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C47H56O4Si/c1-46(2,3)52(44-25-17-13-18-26-44,45-27-19-14-20-28-45)51-38-22-11-9-7-6-8-10-21-37-50-47(39-23-15-12-16-24-39,40-29-33-42(48-4)34-30-40)41-31-35-43(49-5)36-32-41/h7,9,12-20,23-36H,6,8,10-11,21-22,37-38H2,1-5H3/b9-7+ |
| InChIKey | JKOMTZJNJCWFJF-VQHVLOKHSA-N |
| XLogP | 10.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.05 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|