C26H38OSi — CID 11188599
tert-butyl-[(E)-dec-5-enoxy]-diphenylsilane (PubChem CID 11188599) has the molecular formula C26H38OSi and a molecular weight of 394.68 g/mol. Its IUPAC name is tert-butyl-[(E)-dec-5-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-dec-5-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11188599 |
| Molecular Formula | C26H38OSi |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | tert-butyl-[(E)-dec-5-enoxy]-diphenylsilane |
| SMILES | CCCC/C=C/CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H38OSi/c1-5-6-7-8-9-10-11-18-23-27-28(26(2,3)4,24-19-14-12-15-20-24)25-21-16-13-17-22-25/h8-9,12-17,19-22H,5-7,10-11,18,23H2,1-4H3/b9-8+ |
| InChIKey | FVDYLVPATATXNV-CMDGGOBGSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|