C39H62O2Si2 — CID 102494449
tert-butyl-[(6S,7E,9E,12E)-17-[tert-butyl(dimethyl)silyl]oxyheptadeca-7,9,12-trien-6-yl]oxy-diphenylsilane (PubChem CID 102494449) has the molecular formula C39H62O2Si2 and a molecular weight of 619.10 g/mol. Its IUPAC name is tert-butyl-[(6S,7E,9E,12E)-17-[tert-butyl(dimethyl)silyl]oxyheptadeca-7,9,12-trien-6-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(6S,7E,9E,12E)-17-[tert-butyl(dimethyl)silyl]oxyheptadeca-7,9,12-trien-6-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 102494449 |
| Molecular Formula | C39H62O2Si2 |
| Molecular Weight | 619.10 g/mol |
| Exact Mass | 618.43 |
| IUPAC Name | tert-butyl-[(6S,7E,9E,12E)-17-[tert-butyl(dimethyl)silyl]oxyheptadeca-7,9,12-trien-6-yl]oxy-diphenylsilane |
| SMILES | CCCCC[C@@H](/C=C/C=C/C/C=C/CCCCO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H62O2Si2/c1-10-11-21-28-35(29-22-17-15-13-12-14-16-18-27-34-40-42(8,9)38(2,3)4)41-43(39(5,6)7,36-30-23-19-24-31-36)37-32-25-20-26-33-37/h12,14-15,17,19-20,22-26,29-33,35H,10-11,13,16,18,21,27-28,34H2,1-9H3/b14-12+,17-15+,29-22+/t35-/m0/s1 |
| InChIKey | KBAYVUMROVRBEN-MLXRGPFFSA-N |
| XLogP | 10.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.10 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|