C33H56O2Si2 — CID 156806459
tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxyundecan-3-yloxy]-diphenylsilane (PubChem CID 156806459) has the molecular formula C33H56O2Si2 and a molecular weight of 540.98 g/mol. Its IUPAC name is tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxyundecan-3-yloxy]-diphenylsilane.
| Compound Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxyundecan-3-yloxy]-diphenylsilane |
|---|---|
| PubChem CID | 156806459 |
| Molecular Formula | C33H56O2Si2 |
| Molecular Weight | 540.98 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxyundecan-3-yloxy]-diphenylsilane |
| SMILES | CCCCCCCCC(CCO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H56O2Si2/c1-10-11-12-13-14-17-22-29(27-28-34-36(8,9)32(2,3)4)35-37(33(5,6)7,30-23-18-15-19-24-30)31-25-20-16-21-26-31/h15-16,18-21,23-26,29H,10-14,17,22,27-28H2,1-9H3 |
| InChIKey | JNXKJQKZBRGKOQ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.98 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|