C29H46O2Si2 — CID 91526312
tert-butyl-[(3S)-1-[tert-butyl(dimethyl)silyl]oxyhept-5-en-3-yl]oxy-diphenylsilane (PubChem CID 91526312) has the molecular formula C29H46O2Si2 and a molecular weight of 482.86 g/mol. Its IUPAC name is tert-butyl-[(3S)-1-[tert-butyl(dimethyl)silyl]oxyhept-5-en-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(3S)-1-[tert-butyl(dimethyl)silyl]oxyhept-5-en-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 91526312 |
| Molecular Formula | C29H46O2Si2 |
| Molecular Weight | 482.86 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | tert-butyl-[(3S)-1-[tert-butyl(dimethyl)silyl]oxyhept-5-en-3-yl]oxy-diphenylsilane |
| SMILES | CC=CC[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H46O2Si2/c1-10-11-18-25(23-24-30-32(8,9)28(2,3)4)31-33(29(5,6)7,26-19-14-12-15-20-26)27-21-16-13-17-22-27/h10-17,19-22,25H,18,23-24H2,1-9H3/t25-/m0/s1 |
| InChIKey | OYVWEYBIFOUNJO-VWLOTQADSA-N |
| XLogP | 7.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.86 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|