C15H27NO2Si — CID 71251740
O-[3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropyl]hydroxylamine (PubChem CID 71251740) has the molecular formula C15H27NO2Si and a molecular weight of 281.47 g/mol. Its IUPAC name is O-[3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropyl]hydroxylamine.
| Compound Name | O-[3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropyl]hydroxylamine |
|---|---|
| PubChem CID | 71251740 |
| Molecular Formula | C15H27NO2Si |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | O-[3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropyl]hydroxylamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(ON)c1ccccc1 |
| InChI | InChI=1S/C15H27NO2Si/c1-15(2,3)19(4,5)17-12-11-14(18-16)13-9-7-6-8-10-13/h6-10,14H,11-12,16H2,1-5H3 |
| InChIKey | JRRUNOQQRAFIDH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|