C17H30O4Si — CID 10853609
(1R,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylpentane-1,2,3-triol (PubChem CID 10853609) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is (1R,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylpentane-1,2,3-triol.
| Compound Name | (1R,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylpentane-1,2,3-triol |
|---|---|
| PubChem CID | 10853609 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (1R,2S,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylpentane-1,2,3-triol |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](O)[C@H](O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H30O4Si/c1-17(2,3)22(4,5)21-12-11-14(18)16(20)15(19)13-9-7-6-8-10-13/h6-10,14-16,18-20H,11-12H2,1-5H3/t14-,15-,16+/m1/s1 |
| InChIKey | TZZCMKYCKWSNLB-OAGGEKHMSA-N |
| XLogP | 2.85 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|