C22H38O4Si — CID 134970527
(3S,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-7-phenylmethoxyheptane-3,5-diol (PubChem CID 134970527) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is (3S,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-7-phenylmethoxyheptane-3,5-diol.
| Compound Name | (3S,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-7-phenylmethoxyheptane-3,5-diol |
|---|---|
| PubChem CID | 134970527 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (3S,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-7-phenylmethoxyheptane-3,5-diol |
| SMILES | C=C[C@H]([C@@H](O)CCOCc1ccccc1)[C@@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O4Si/c1-7-19(21(24)14-16-26-27(5,6)22(2,3)4)20(23)13-15-25-17-18-11-9-8-10-12-18/h7-12,19-21,23-24H,1,13-17H2,2-6H3/t19-,20+,21+/m1/s1 |
| InChIKey | YXFHEKARUSQPDS-HKBOAZHASA-N |
| XLogP | 4.53 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|