C18H30O3Si — CID 101470111
(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypent-4-en-2-ol (PubChem CID 101470111) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is (2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypent-4-en-2-ol.
| Compound Name | (2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypent-4-en-2-ol |
|---|---|
| PubChem CID | 101470111 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypent-4-en-2-ol |
| SMILES | C=C[C@H](OCc1ccccc1)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O3Si/c1-7-17(20-13-15-11-9-8-10-12-15)16(19)14-21-22(5,6)18(2,3)4/h7-12,16-17,19H,1,13-14H2,2-6H3/t16-,17+/m1/s1 |
| InChIKey | QVJWHOQRCXIXNW-SJORKVTESA-N |
| XLogP | 4.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|