C30H48O3Si2 — CID 101378913
(2S,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-4-ethenyl-2-phenylmethoxyheptan-3-ol (PubChem CID 101378913) has the molecular formula C30H48O3Si2 and a molecular weight of 512.88 g/mol. Its IUPAC name is (2S,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-4-ethenyl-2-phenylmethoxyheptan-3-ol.
| Compound Name | (2S,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-4-ethenyl-2-phenylmethoxyheptan-3-ol |
|---|---|
| PubChem CID | 101378913 |
| Molecular Formula | C30H48O3Si2 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | (2S,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-4-ethenyl-2-phenylmethoxyheptan-3-ol |
| SMILES | C=C[C@](CCC)([C@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)OCc1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C30H48O3Si2/c1-10-22-30(11-2,34(6,7)26-20-16-13-17-21-26)28(31)27(24-33-35(8,9)29(3,4)5)32-23-25-18-14-12-15-19-25/h11-21,27-28,31H,2,10,22-24H2,1,3-9H3/t27-,28+,30-/m0/s1 |
| InChIKey | XUIDQPBKTHNLKG-LXQNXJGFSA-N |
| XLogP | 7.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|