C27H39NO6Si — CID 24800995
benzyl N-[(2S,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-hydroxy-4-phenylmethoxypentyl]carbamate (PubChem CID 24800995) has the molecular formula C27H39NO6Si and a molecular weight of 501.70 g/mol. Its IUPAC name is benzyl N-[(2S,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-hydroxy-4-phenylmethoxypentyl]carbamate.
| Compound Name | benzyl N-[(2S,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-hydroxy-4-phenylmethoxypentyl]carbamate |
|---|---|
| PubChem CID | 24800995 |
| Molecular Formula | C27H39NO6Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | benzyl N-[(2S,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-hydroxy-4-phenylmethoxypentyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](OCc1ccccc1)[C@H](O)[C@@H](C=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H39NO6Si/c1-27(2,3)35(4,5)34-20-24(32-18-21-12-8-6-9-13-21)25(30)23(17-29)16-28-26(31)33-19-22-14-10-7-11-15-22/h6-15,17,23-25,30H,16,18-20H2,1-5H3,(H,28,31)/t23-,24-,25-/m1/s1 |
| InChIKey | NPPAZMCFZQJJBB-UBFVSLLYSA-N |
| XLogP | 4.70 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|