C18H29NO4Si — CID 175899923
benzyl N-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxobutan-2-yl]carbamate (PubChem CID 175899923) has the molecular formula C18H29NO4Si and a molecular weight of 351.52 g/mol. Its IUPAC name is benzyl N-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 175899923 |
| Molecular Formula | C18H29NO4Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | benzyl N-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H](C=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H29NO4Si/c1-18(2,3)24(4,5)23-12-11-16(13-20)19-17(21)22-14-15-9-7-6-8-10-15/h6-10,13,16H,11-12,14H2,1-5H3,(H,19,21)/t16-/m1/s1 |
| InChIKey | HZOIGLBJFOYZAM-MRXNPFEDSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|