C14H17NO5 — CID 138593284
methyl 5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 138593284) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is methyl 5-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl 5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 138593284 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl 5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)CCC(C=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO5/c1-19-13(17)8-7-12(9-16)15-14(18)20-10-11-5-3-2-4-6-11/h2-6,9,12H,7-8,10H2,1H3,(H,15,18) |
| InChIKey | MKQOZFPYTXNORN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|