C15H23BN2O4 — CID 174089107
methyl-N-[6-oxo-5-(phenylmethoxycarbonylamino)hexyl]boronamidic acid (PubChem CID 174089107) has the molecular formula C15H23BN2O4 and a molecular weight of 306.17 g/mol. Its IUPAC name is methyl-N-[6-oxo-5-(phenylmethoxycarbonylamino)hexyl]boronamidic acid.
| Compound Name | methyl-N-[6-oxo-5-(phenylmethoxycarbonylamino)hexyl]boronamidic acid |
|---|---|
| PubChem CID | 174089107 |
| Molecular Formula | C15H23BN2O4 |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | methyl-N-[6-oxo-5-(phenylmethoxycarbonylamino)hexyl]boronamidic acid |
| SMILES | CB(O)NCCCCC(C=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H23BN2O4/c1-16(21)17-10-6-5-9-14(11-19)18-15(20)22-12-13-7-3-2-4-8-13/h2-4,7-8,11,14,17,21H,5-6,9-10,12H2,1H3,(H,18,20) |
| InChIKey | PXTSSBQVSVPTNG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|