C21H33NO2 — CID 102473068
benzyl N-[(E)-tridec-7-en-6-yl]carbamate (PubChem CID 102473068) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is benzyl N-[(E)-tridec-7-en-6-yl]carbamate.
| Compound Name | benzyl N-[(E)-tridec-7-en-6-yl]carbamate |
|---|---|
| PubChem CID | 102473068 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | benzyl N-[(E)-tridec-7-en-6-yl]carbamate |
| SMILES | CCCCC/C=C/C(CCCCC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H33NO2/c1-3-5-7-8-13-17-20(16-10-6-4-2)22-21(23)24-18-19-14-11-9-12-15-19/h9,11-15,17,20H,3-8,10,16,18H2,1-2H3,(H,22,23)/b17-13+ |
| InChIKey | FGTSMKNKNUVARM-GHRIWEEISA-N |
| XLogP | 6.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|