C25H39NO4S — CID 102264328
methyl (2R)-2-(phenylmethoxycarbonylamino)-3-[(E)-tridec-2-enyl]sulfanylpropanoate (PubChem CID 102264328) has the molecular formula C25H39NO4S and a molecular weight of 449.66 g/mol. Its IUPAC name is methyl (2R)-2-(phenylmethoxycarbonylamino)-3-[(E)-tridec-2-enyl]sulfanylpropanoate.
| Compound Name | methyl (2R)-2-(phenylmethoxycarbonylamino)-3-[(E)-tridec-2-enyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 102264328 |
| Molecular Formula | C25H39NO4S |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | methyl (2R)-2-(phenylmethoxycarbonylamino)-3-[(E)-tridec-2-enyl]sulfanylpropanoate |
| SMILES | CCCCCCCCCC/C=C/CSC[C@H](NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C25H39NO4S/c1-3-4-5-6-7-8-9-10-11-12-16-19-31-21-23(24(27)29-2)26-25(28)30-20-22-17-14-13-15-18-22/h12-18,23H,3-11,19-21H2,1-2H3,(H,26,28)/b16-12+/t23-/m0/s1 |
| InChIKey | XDQACWRPHHDACD-DTPJYZGHSA-N |
| XLogP | 6.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|