C19H35NO3S — CID 102264321
methyl (2R)-2-acetamido-3-[(E)-tridec-2-enyl]sulfanylpropanoate (PubChem CID 102264321) has the molecular formula C19H35NO3S and a molecular weight of 357.56 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-[(E)-tridec-2-enyl]sulfanylpropanoate.
| Compound Name | methyl (2R)-2-acetamido-3-[(E)-tridec-2-enyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 102264321 |
| Molecular Formula | C19H35NO3S |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | methyl (2R)-2-acetamido-3-[(E)-tridec-2-enyl]sulfanylpropanoate |
| SMILES | CCCCCCCCCC/C=C/CSC[C@H](NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C19H35NO3S/c1-4-5-6-7-8-9-10-11-12-13-14-15-24-16-18(19(22)23-3)20-17(2)21/h13-14,18H,4-12,15-16H2,1-3H3,(H,20,21)/b14-13+/t18-/m0/s1 |
| InChIKey | HTQQLLYMLFIQOW-JKGDOXCYSA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|