C44H76N2O6S2 — CID 126512520
methyl (2R)-3-[[(2R)-3-methoxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-3-oxopropyl]disulfanyl]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propanoate (PubChem CID 126512520) has the molecular formula C44H76N2O6S2 and a molecular weight of 793.23 g/mol. Its IUPAC name is methyl (2R)-3-[[(2R)-3-methoxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-3-oxopropyl]disulfanyl]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propanoate.
| Compound Name | methyl (2R)-3-[[(2R)-3-methoxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-3-oxopropyl]disulfanyl]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propanoate |
|---|---|
| PubChem CID | 126512520 |
| Molecular Formula | C44H76N2O6S2 |
| Molecular Weight | 793.23 g/mol |
| Exact Mass | 792.51 |
| IUPAC Name | methyl (2R)-3-[[(2R)-3-methoxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-3-oxopropyl]disulfanyl]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N[C@@H](CSSC[C@H](NC(=O)CCCCCCC/C=C\C/C=C\CCCCC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C44H76N2O6S2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(47)45-39(43(49)51-3)37-53-54-38-40(44(50)52-4)46-42(48)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,39-40H,5-12,17-18,23-38H2,1-4H3,(H,45,47)(H,46,48)/b15-13-,16-14-,21-19-,22-20-/t39-,40-/m0/s1 |
| InChIKey | OTIGQNIZSSDFPV-QEDXHPGKSA-N |
| XLogP | 11.31 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.23 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|