C26H47NO3 — CID 171116894
(2S)-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]-4-methylpentanoic acid (PubChem CID 171116894) has the molecular formula C26H47NO3 and a molecular weight of 421.67 g/mol. Its IUPAC name is (2S)-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 171116894 |
| Molecular Formula | C26H47NO3 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.36 |
| IUPAC Name | (2S)-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]-4-methylpentanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C26H47NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)27-24(26(29)30)22-23(2)3/h8-9,11-12,23-24H,4-7,10,13-22H2,1-3H3,(H,27,28)(H,29,30)/b9-8-,12-11-/t24-/m0/s1 |
| InChIKey | XBIXDNGUKPQNJF-KGVJGNKBSA-N |
| XLogP | 7.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|