C24H42NNaO3 — CID 141395203
sodium (2S)-4-methyl-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanoate (PubChem CID 141395203) has the molecular formula C24H42NNaO3 and a molecular weight of 415.59 g/mol. Its IUPAC name is sodium (2S)-4-methyl-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanoate.
| Compound Name | sodium (2S)-4-methyl-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanoate |
|---|---|
| PubChem CID | 141395203 |
| Molecular Formula | C24H42NNaO3 |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | sodium (2S)-4-methyl-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N[C@@H](CC(C)C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C24H43NO3.Na/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)25-22(24(27)28)20-21(2)3;/h8-9,11-12,21-22H,4-7,10,13-20H2,1-3H3,(H,25,26)(H,27,28);/q;+1/p-1/b9-8-,12-11-;/t22-;/m0./s1 |
| InChIKey | VYMURFXUFIISQE-NWNBJYJBSA-M |
| XLogP | 2.08 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|