C22H45N3O5 — CID 139658985
diazanium;(2S)-2-[[(Z)-octadec-9-enoyl]amino]butanedioate (PubChem CID 139658985) has the molecular formula C22H45N3O5 and a molecular weight of 431.62 g/mol. Its IUPAC name is diazanium;(2S)-2-[[(Z)-octadec-9-enoyl]amino]butanedioate.
| Compound Name | diazanium;(2S)-2-[[(Z)-octadec-9-enoyl]amino]butanedioate |
|---|---|
| PubChem CID | 139658985 |
| Molecular Formula | C22H45N3O5 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | diazanium;(2S)-2-[[(Z)-octadec-9-enoyl]amino]butanedioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CC(=O)[O-])C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C22H39NO5.2H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)23-19(22(27)28)18-21(25)26;;/h9-10,19H,2-8,11-18H2,1H3,(H,23,24)(H,25,26)(H,27,28);2*1H3/b10-9-;;/t19-;;/m0../s1 |
| InChIKey | OZKPTPYWSHPAJZ-LXBBHARASA-N |
| XLogP | 3.15 |
| TPSA | 182.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|