C17H30KNO5 — CID 71587285
potassium;(2S)-2-(dodecanoylamino)pentanedioate;hydron (PubChem CID 71587285) has the molecular formula C17H30KNO5 and a molecular weight of 367.53 g/mol. Its IUPAC name is potassium;(2S)-2-(dodecanoylamino)pentanedioate;hydron.
| Compound Name | potassium;(2S)-2-(dodecanoylamino)pentanedioate;hydron |
|---|---|
| PubChem CID | 71587285 |
| Molecular Formula | C17H30KNO5 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | potassium;(2S)-2-(dodecanoylamino)pentanedioate;hydron |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[H+].[K+] |
| InChI | InChI=1S/C17H31NO5.K/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);/q;+1/p-1/t14-;/m0./s1 |
| InChIKey | WNEHWYCWKDNRFW-UQKRIMTDSA-M |
| XLogP | -2.21 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|