C11H20NNaO3S — CID 141400638
sodium (2S)-2-(hexanoylamino)-4-methylsulfanylbutanoate (PubChem CID 141400638) has the molecular formula C11H20NNaO3S and a molecular weight of 269.34 g/mol. Its IUPAC name is sodium (2S)-2-(hexanoylamino)-4-methylsulfanylbutanoate.
| Compound Name | sodium (2S)-2-(hexanoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 141400638 |
| Molecular Formula | C11H20NNaO3S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | sodium (2S)-2-(hexanoylamino)-4-methylsulfanylbutanoate |
| SMILES | CCCCCC(=O)N[C@@H](CCSC)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H21NO3S.Na/c1-3-4-5-6-10(13)12-9(11(14)15)7-8-16-2;/h9H,3-8H2,1-2H3,(H,12,13)(H,14,15);/q;+1/p-1/t9-;/m0./s1 |
| InChIKey | ALRNQUIABWUECM-FVGYRXGTSA-M |
| XLogP | -2.44 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|