C16H28N2O6S2 — CID 40571539
(2R)-2-[[6-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-6-oxohexanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 40571539) has the molecular formula C16H28N2O6S2 and a molecular weight of 408.54 g/mol. Its IUPAC name is (2R)-2-[[6-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-6-oxohexanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[6-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-6-oxohexanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 40571539 |
| Molecular Formula | C16H28N2O6S2 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (2R)-2-[[6-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-6-oxohexanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)CCCCC(=O)N[C@H](CCSC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H28N2O6S2/c1-25-9-7-11(15(21)22)17-13(19)5-3-4-6-14(20)18-12(16(23)24)8-10-26-2/h11-12H,3-10H2,1-2H3,(H,17,19)(H,18,20)(H,21,22)(H,23,24)/t11-,12-/m1/s1 |
| InChIKey | AAQSJRQBAJECJX-VXGBXAGGSA-N |
| XLogP | 1.19 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|