C24H44N2O6S2 — CID 87455751
(2S)-4-[[(3S)-3-carboxy-3-(octanoylamino)propyl]disulfanyl]-2-(octanoylamino)butanoic acid (PubChem CID 87455751) has the molecular formula C24H44N2O6S2 and a molecular weight of 520.76 g/mol. Its IUPAC name is (2S)-4-[[(3S)-3-carboxy-3-(octanoylamino)propyl]disulfanyl]-2-(octanoylamino)butanoic acid.
| Compound Name | (2S)-4-[[(3S)-3-carboxy-3-(octanoylamino)propyl]disulfanyl]-2-(octanoylamino)butanoic acid |
|---|---|
| PubChem CID | 87455751 |
| Molecular Formula | C24H44N2O6S2 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (2S)-4-[[(3S)-3-carboxy-3-(octanoylamino)propyl]disulfanyl]-2-(octanoylamino)butanoic acid |
| SMILES | CCCCCCCC(=O)N[C@@H](CCSSCC[C@H](NC(=O)CCCCCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H44N2O6S2/c1-3-5-7-9-11-13-21(27)25-19(23(29)30)15-17-33-34-18-16-20(24(31)32)26-22(28)14-12-10-8-6-4-2/h19-20H,3-18H2,1-2H3,(H,25,27)(H,26,28)(H,29,30)(H,31,32)/t19-,20-/m0/s1 |
| InChIKey | NDLIOFOABMYBNT-PMACEKPBSA-N |
| XLogP | 5.01 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|